2,4,6-Trichloro
Catalog No: FT-0675439
CAS No: 352439-08-8
- Chemical Name: 2,4,6-Trichloro
- Molecular Formula: C7H5Cl3O
- Molecular Weight: 216.5
- InChI Key: WCVOGSZTONGSQY-RHIBPKLGSA-N
- InChI: InChI=1S/C7H5Cl3O/c1-11-7-5(9)2-4(8)3-6(7)10/h2-3H,1H3/i1D3,2D,3D
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 216.50400 |
| Density: | 1.45 g/cm3 |
| CAS: | 352439-08-8 |
| Bolling_Point: | 246ºC at 760 mmHg |
| Product_Name: | 1,3,5-trichloro-2,4-dideuterio-6-(trideuteriomethoxy)benzene |
| Melting_Point: | 60-62ºC(lit.) |
| Flash_Point: | N/A |
| MF: | C7Cl3D5O |
| Melting_Point: | 60-62ºC(lit.) |
|---|---|
| Density: | 1.45 g/cm3 |
| LogP: | 3.65540 |
| Refractive_Index: | 1.55 |
| FW: | 216.50400 |
| PSA: | 9.23000 |
| MF: | C7Cl3D5O |
| Bolling_Point: | 246ºC at 760 mmHg |
| Exact_Mass: | 214.97200 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xn |
| Risk_Statements(EU): | 22-36 |
| Safety_Statements: | 26 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P305 + P351 + P338 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)